C10H10F12O3 — CID 167586257
fluoromethane;2,2,3,5,6-pentafluoro-3-methyl-6-(trifluoromethyl)-5-(1,2,3-trifluoropropan-2-yloxy)-1,4-dioxane (PubChem CID 167586257) has the molecular formula C10H10F12O3 and a molecular weight of 406.16 g/mol. Its IUPAC name is fluoromethane;2,2,3,5,6-pentafluoro-3-methyl-6-(trifluoromethyl)-5-(1,2,3-trifluoropropan-2-yloxy)-1,4-dioxane.
| Compound Name | fluoromethane;2,2,3,5,6-pentafluoro-3-methyl-6-(trifluoromethyl)-5-(1,2,3-trifluoropropan-2-yloxy)-1,4-dioxane |
|---|---|
| PubChem CID | 167586257 |
| Molecular Formula | C10H10F12O3 |
| Molecular Weight | 406.16 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | fluoromethane;2,2,3,5,6-pentafluoro-3-methyl-6-(trifluoromethyl)-5-(1,2,3-trifluoropropan-2-yloxy)-1,4-dioxane |
| SMILES | CC1(F)OC(F)(OC(F)(CF)CF)C(F)(C(F)(F)F)OC1(F)F.CF |
| InChI | InChI=1S/C9H7F11O3.CH3F/c1-4(12)8(18,19)23-6(14,7(15,16)17)9(20,21-4)22-5(13,2-10)3-11;1-2/h2-3H2,1H3;1H3 |
| InChIKey | HVNSHYWWAFDQMO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.16 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |