C12F22O5 — CID 21133315
[difluoro-[4,4,5-trifluoro-2,5-bis(trifluoromethyl)-1,3-dioxolan-2-yl]methyl] 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate (PubChem CID 21133315) has the molecular formula C12F22O5 and a molecular weight of 642.08 g/mol. Its IUPAC name is [difluoro-[4,4,5-trifluoro-2,5-bis(trifluoromethyl)-1,3-dioxolan-2-yl]methyl] 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate.
| Compound Name | [difluoro-[4,4,5-trifluoro-2,5-bis(trifluoromethyl)-1,3-dioxolan-2-yl]methyl] 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate |
|---|---|
| PubChem CID | 21133315 |
| Molecular Formula | C12F22O5 |
| Molecular Weight | 642.08 g/mol |
| Exact Mass | 641.94 |
| IUPAC Name | [difluoro-[4,4,5-trifluoro-2,5-bis(trifluoromethyl)-1,3-dioxolan-2-yl]methyl] 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate |
| SMILES | O=C(OC(F)(F)C1(C(F)(F)F)OC(F)(F)C(F)(C(F)(F)F)O1)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12F22O5/c13-2(6(17,18)19,37-10(29,30)3(14,15)7(20,21)22)1(35)36-12(33,34)5(9(26,27)28)38-4(16,8(23,24)25)11(31,32)39-5 |
| InChIKey | AAEBZMRFOBQDAG-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.08 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|