C4F8O3S — CID 169224044
1,1,2,2-tetrafluoro-2-(2,3,3-trifluorooxiran-2-yl)ethanesulfonyl fluoride (PubChem CID 169224044) has the molecular formula C4F8O3S and a molecular weight of 280.09 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-(2,3,3-trifluorooxiran-2-yl)ethanesulfonyl fluoride.
| Compound Name | 1,1,2,2-tetrafluoro-2-(2,3,3-trifluorooxiran-2-yl)ethanesulfonyl fluoride |
|---|---|
| PubChem CID | 169224044 |
| Molecular Formula | C4F8O3S |
| Molecular Weight | 280.09 g/mol |
| Exact Mass | 279.94 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-(2,3,3-trifluorooxiran-2-yl)ethanesulfonyl fluoride |
| SMILES | O=S(=O)(F)C(F)(F)C(F)(F)C1(F)OC1(F)F |
| InChI | InChI=1S/C4F8O3S/c5-1(6,2(7)3(8,9)15-2)4(10,11)16(12,13)14 |
| InChIKey | DDRLHAWBRLNQKL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.09 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|