C2F5IO2S — CID 19898065
1,1,2,2-tetrafluoro-2-iodoethanesulfonyl fluoride (PubChem CID 19898065) has the molecular formula C2F5IO2S and a molecular weight of 309.98 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-iodoethanesulfonyl fluoride.
| Compound Name | 1,1,2,2-tetrafluoro-2-iodoethanesulfonyl fluoride |
|---|---|
| PubChem CID | 19898065 |
| Molecular Formula | C2F5IO2S |
| Molecular Weight | 309.98 g/mol |
| Exact Mass | 309.86 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-iodoethanesulfonyl fluoride |
| SMILES | O=S(=O)(F)C(F)(F)C(F)(F)I |
| InChI | InChI=1S/C2F5IO2S/c3-1(4,8)2(5,6)11(7,9)10 |
| InChIKey | WXPCGHJEXNXQMF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.98 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|