C3CsF7O5S2 — CID 23676032
cesium 1,1,2,2,3,3-hexafluoro-3-fluorosulfonylpropane-1-sulfonate (PubChem CID 23676032) has the molecular formula C3CsF7O5S2 and a molecular weight of 446.05 g/mol. Its IUPAC name is cesium 1,1,2,2,3,3-hexafluoro-3-fluorosulfonylpropane-1-sulfonate.
| Compound Name | cesium 1,1,2,2,3,3-hexafluoro-3-fluorosulfonylpropane-1-sulfonate |
|---|---|
| PubChem CID | 23676032 |
| Molecular Formula | C3CsF7O5S2 |
| Molecular Weight | 446.05 g/mol |
| Exact Mass | 445.81 |
| IUPAC Name | cesium 1,1,2,2,3,3-hexafluoro-3-fluorosulfonylpropane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)F.[Cs+] |
| InChI | InChI=1S/C3HF7O5S2.Cs/c4-1(5,2(6,7)16(10,11)12)3(8,9)17(13,14)15;/h(H,13,14,15);/q;+1/p-1 |
| InChIKey | ZMEQZZLRTJSPKX-UHFFFAOYSA-M |
| XLogP | -2.34 |
| TPSA | 91.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.05 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|