C2HF5O5S2 — CID 15135176
1,1,2,2-tetrafluoro-2-fluorosulfonylethanesulfonic acid (PubChem CID 15135176) has the molecular formula C2HF5O5S2 and a molecular weight of 264.15 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-fluorosulfonylethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-fluorosulfonylethanesulfonic acid |
|---|---|
| PubChem CID | 15135176 |
| Molecular Formula | C2HF5O5S2 |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 263.92 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-fluorosulfonylethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)S(=O)(=O)F |
| InChI | InChI=1S/C2HF5O5S2/c3-1(4,13(7,8)9)2(5,6)14(10,11)12/h(H,10,11,12) |
| InChIKey | INGSRQUVJSHALN-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|