C9H12F8O — CID 159803316
2-(1,1-difluoroethyl)-3-ethyl-2,3,4,4,5,5-hexafluorooxolane;methane (PubChem CID 159803316) has the molecular formula C9H12F8O and a molecular weight of 288.18 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-3-ethyl-2,3,4,4,5,5-hexafluorooxolane;methane.
| Compound Name | 2-(1,1-difluoroethyl)-3-ethyl-2,3,4,4,5,5-hexafluorooxolane;methane |
|---|---|
| PubChem CID | 159803316 |
| Molecular Formula | C9H12F8O |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2-(1,1-difluoroethyl)-3-ethyl-2,3,4,4,5,5-hexafluorooxolane;methane |
| SMILES | C.CCC1(F)C(F)(F)C(F)(F)OC1(F)C(C)(F)F |
| InChI | InChI=1S/C8H8F8O.CH4/c1-3-5(11)6(12,13)8(15,16)17-7(5,14)4(2,9)10;/h3H2,1-2H3;1H4 |
| InChIKey | NKBKZOYPVIPXQH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|