About 2-(1,1-difluoroethyl)-2,3,3,5,5-pentafluorooxolane
2-(1,1-difluoroethyl)-2,3,3,5,5-pentafluorooxolane (PubChem CID 20700669) has the molecular formula C6H5F7O
and a molecular weight of 226.09 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-2,3,3,5,5-pentafluorooxolane.
Analyze 2-(1,1-difluoroethyl)-2,3,3,5,5-pentafluorooxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-difluoroethyl)-2,3,3,5,5-pentafluorooxolane?
The IUPAC name of 2-(1,1-difluoroethyl)-2,3,3,5,5-pentafluorooxolane (CID 20700669) is 2-(1,1-difluoroethyl)-2,3,3,5,5-pentafluorooxolane.
What is the SMILES notation for 2-(1,1-difluoroethyl)-2,3,3,5,5-pentafluorooxolane?
The canonical SMILES for 2-(1,1-difluoroethyl)-2,3,3,5,5-pentafluorooxolane is CC(F)(F)C1(F)OC(F)(F)CC1(F)F.
What is the InChIKey of 2-(1,1-difluoroethyl)-2,3,3,5,5-pentafluorooxolane?
The InChIKey is HPXMBFZLOVBBKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F7O/c1-3(7,8)6(13)4(9,10)2-5(11,12)14-6/h2H2,1H3.
What are the key properties of 2-(1,1-difluoroethyl)-2,3,3,5,5-pentafluorooxolane?
2-(1,1-difluoroethyl)-2,3,3,5,5-pentafluorooxolane has a molecular weight of 226.09 g/mol, XLogP of 2.96, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-difluoroethyl)-2,3,3,5,5-pentafluorooxolane is sourced from PubChem (CID 20700669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).