C6H5F7O — CID 58545270
5-(1,1-difluoroethyl)-2,2,3,3,5-pentafluorooxolane (PubChem CID 58545270) has the molecular formula C6H5F7O and a molecular weight of 226.09 g/mol. Its IUPAC name is 5-(1,1-difluoroethyl)-2,2,3,3,5-pentafluorooxolane.
| Compound Name | 5-(1,1-difluoroethyl)-2,2,3,3,5-pentafluorooxolane |
|---|---|
| PubChem CID | 58545270 |
| Molecular Formula | C6H5F7O |
| Molecular Weight | 226.09 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | 5-(1,1-difluoroethyl)-2,2,3,3,5-pentafluorooxolane |
| SMILES | CC(F)(F)C1(F)CC(F)(F)C(F)(F)O1 |
| InChI | InChI=1S/C6H5F7O/c1-3(7,8)5(11)2-4(9,10)6(12,13)14-5/h2H2,1H3 |
| InChIKey | LGDPMDNJVVKHAQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.09 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|