C6H5F7O — CID 18710857
2,2,3,3,5,5,6-heptafluoro-6-methyloxane (PubChem CID 18710857) has the molecular formula C6H5F7O and a molecular weight of 226.09 g/mol. Its IUPAC name is 2,2,3,3,5,5,6-heptafluoro-6-methyloxane.
| Compound Name | 2,2,3,3,5,5,6-heptafluoro-6-methyloxane |
|---|---|
| PubChem CID | 18710857 |
| Molecular Formula | C6H5F7O |
| Molecular Weight | 226.09 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | 2,2,3,3,5,5,6-heptafluoro-6-methyloxane |
| SMILES | CC1(F)OC(F)(F)C(F)(F)CC1(F)F |
| InChI | InChI=1S/C6H5F7O/c1-3(7)4(8,9)2-5(10,11)6(12,13)14-3/h2H2,1H3 |
| InChIKey | WIIVRQBYUSFEPP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.09 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|