C7H7F7O — CID 20700670
2-(1,1-difluoroethyl)-2,3,3,5,5-pentafluorooxane (PubChem CID 20700670) has the molecular formula C7H7F7O and a molecular weight of 240.12 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-2,3,3,5,5-pentafluorooxane.
| Compound Name | 2-(1,1-difluoroethyl)-2,3,3,5,5-pentafluorooxane |
|---|---|
| PubChem CID | 20700670 |
| Molecular Formula | C7H7F7O |
| Molecular Weight | 240.12 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 2-(1,1-difluoroethyl)-2,3,3,5,5-pentafluorooxane |
| SMILES | CC(F)(F)C1(F)OCC(F)(F)CC1(F)F |
| InChI | InChI=1S/C7H7F7O/c1-4(8,9)7(14)6(12,13)2-5(10,11)3-15-7/h2-3H2,1H3 |
| InChIKey | GVYWNBBLPZJREV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.12 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |