C9H5F13O — CID 19898569
2,3,4,5-tetrafluoro-6-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxane (PubChem CID 19898569) has the molecular formula C9H5F13O and a molecular weight of 376.11 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-6-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxane.
| Compound Name | 2,3,4,5-tetrafluoro-6-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxane |
|---|---|
| PubChem CID | 19898569 |
| Molecular Formula | C9H5F13O |
| Molecular Weight | 376.11 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 2,3,4,5-tetrafluoro-6-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxane |
| SMILES | FC1OC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)C(F)C1F |
| InChI | InChI=1S/C9H5F13O/c10-1-2(11)4(23-5(13)3(1)12)6(14,15)7(16,17)8(18,19)9(20,21)22/h1-5H |
| InChIKey | GVDQTTXVORJGDD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.11 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|