C10H9F11O — CID 19800866
2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)oxane (PubChem CID 19800866) has the molecular formula C10H9F11O and a molecular weight of 354.16 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)oxane.
| Compound Name | 2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)oxane |
|---|---|
| PubChem CID | 19800866 |
| Molecular Formula | C10H9F11O |
| Molecular Weight | 354.16 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)oxane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1CCCCO1 |
| InChI | InChI=1S/C10H9F11O/c11-6(12,5-3-1-2-4-22-5)7(13,14)8(15,16)9(17,18)10(19,20)21/h5H,1-4H2 |
| InChIKey | IRWADQLZPDELMD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.16 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|