About 5-fluoro-2-pentyloxane
5-fluoro-2-pentyloxane (PubChem CID 11275319) has the molecular formula C10H19FO
and a molecular weight of 174.26 g/mol. Its IUPAC name is 5-fluoro-2-pentyloxane.
Molecular Properties
| Compound Name | 5-fluoro-2-pentyloxane |
| PubChem CID | 11275319 |
| Molecular Formula | C10H19FO |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 5-fluoro-2-pentyloxane |
| SMILES | CCCCCC1CCC(F)CO1 |
| InChI | InChI=1S/C10H19FO/c1-2-3-4-5-10-7-6-9(11)8-12-10/h9-10H,2-8H2,1H3 |
| InChIKey | VYDGRIZNXDRMSX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-2-pentyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-pentyloxane?
The IUPAC name of 5-fluoro-2-pentyloxane (CID 11275319) is 5-fluoro-2-pentyloxane.
What is the SMILES notation for 5-fluoro-2-pentyloxane?
The canonical SMILES for 5-fluoro-2-pentyloxane is CCCCCC1CCC(F)CO1.
What is the InChIKey of 5-fluoro-2-pentyloxane?
The InChIKey is VYDGRIZNXDRMSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19FO/c1-2-3-4-5-10-7-6-9(11)8-12-10/h9-10H,2-8H2,1H3.
What are the key properties of 5-fluoro-2-pentyloxane?
5-fluoro-2-pentyloxane has a molecular weight of 174.26 g/mol, XLogP of 3.08, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-pentyloxane is sourced from PubChem (CID 11275319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).