C12H10F12O4 — CID 59628174
2-ethyl-4-[2-ethyl-4,5,5-trifluoro-2-(trifluoromethyl)-1,3-dioxolan-4-yl]-4,5,5-trifluoro-2-(trifluoromethyl)-1,3-dioxolane (PubChem CID 59628174) has the molecular formula C12H10F12O4 and a molecular weight of 446.18 g/mol. Its IUPAC name is 2-ethyl-4-[2-ethyl-4,5,5-trifluoro-2-(trifluoromethyl)-1,3-dioxolan-4-yl]-4,5,5-trifluoro-2-(trifluoromethyl)-1,3-dioxolane.
| Compound Name | 2-ethyl-4-[2-ethyl-4,5,5-trifluoro-2-(trifluoromethyl)-1,3-dioxolan-4-yl]-4,5,5-trifluoro-2-(trifluoromethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 59628174 |
| Molecular Formula | C12H10F12O4 |
| Molecular Weight | 446.18 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 2-ethyl-4-[2-ethyl-4,5,5-trifluoro-2-(trifluoromethyl)-1,3-dioxolan-4-yl]-4,5,5-trifluoro-2-(trifluoromethyl)-1,3-dioxolane |
| SMILES | CCC1(C(F)(F)F)OC(F)(F)C(F)(C2(F)OC(CC)(C(F)(F)F)OC2(F)F)O1 |
| InChI | InChI=1S/C12H10F12O4/c1-3-5(9(15,16)17)25-7(13,11(21,22)27-5)8(14)12(23,24)28-6(4-2,26-8)10(18,19)20/h3-4H2,1-2H3 |
| InChIKey | IBNWFKXMQBGTON-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.18 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |