C12H7F15O5 — CID 88555411
1,1,5,5,7,7,11,11-octafluoro-3-(fluoromethoxymethyl)-9-methyl-3,9-bis(trifluoromethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane (PubChem CID 88555411) has the molecular formula C12H7F15O5 and a molecular weight of 516.15 g/mol. Its IUPAC name is 1,1,5,5,7,7,11,11-octafluoro-3-(fluoromethoxymethyl)-9-methyl-3,9-bis(trifluoromethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane.
| Compound Name | 1,1,5,5,7,7,11,11-octafluoro-3-(fluoromethoxymethyl)-9-methyl-3,9-bis(trifluoromethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 88555411 |
| Molecular Formula | C12H7F15O5 |
| Molecular Weight | 516.15 g/mol |
| Exact Mass | 516.01 |
| IUPAC Name | 1,1,5,5,7,7,11,11-octafluoro-3-(fluoromethoxymethyl)-9-methyl-3,9-bis(trifluoromethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane |
| SMILES | CC1(C(F)(F)F)OC(F)(F)C2(C(F)(F)O1)C(F)(F)OC(COCF)(C(F)(F)F)OC2(F)F |
| InChI | InChI=1S/C12H7F15O5/c1-4(7(14,15)16)29-9(20,21)6(10(22,23)30-4)11(24,25)31-5(2-28-3-13,8(17,18)19)32-12(6,26)27/h2-3H2,1H3 |
| InChIKey | JLBIYRCVCUHRKT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.15 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |