C9H6F12O4 — CID 90337457
4,4,5-trifluoro-5-(1,1,2,2,3,3-hexafluoro-3-methoxypropoxy)-2-methyl-2-(trifluoromethyl)-1,3-dioxolane (PubChem CID 90337457) has the molecular formula C9H6F12O4 and a molecular weight of 406.12 g/mol. Its IUPAC name is 4,4,5-trifluoro-5-(1,1,2,2,3,3-hexafluoro-3-methoxypropoxy)-2-methyl-2-(trifluoromethyl)-1,3-dioxolane.
| Compound Name | 4,4,5-trifluoro-5-(1,1,2,2,3,3-hexafluoro-3-methoxypropoxy)-2-methyl-2-(trifluoromethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 90337457 |
| Molecular Formula | C9H6F12O4 |
| Molecular Weight | 406.12 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 4,4,5-trifluoro-5-(1,1,2,2,3,3-hexafluoro-3-methoxypropoxy)-2-methyl-2-(trifluoromethyl)-1,3-dioxolane |
| SMILES | COC(F)(F)C(F)(F)C(F)(F)OC1(F)OC(C)(C(F)(F)F)OC1(F)F |
| InChI | InChI=1S/C9H6F12O4/c1-3(5(12,13)14)23-8(19,20)9(21,24-3)25-7(17,18)4(10,11)6(15,16)22-2/h1-2H3 |
| InChIKey | IEPQIASSQNSEMB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.12 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|