C5H6F5O4P — CID 12829625
2-dimethoxyphosphoryl-3,3-difluoro-2-(trifluoromethyl)oxirane (PubChem CID 12829625) has the molecular formula C5H6F5O4P and a molecular weight of 256.06 g/mol. Its IUPAC name is 2-dimethoxyphosphoryl-3,3-difluoro-2-(trifluoromethyl)oxirane.
| Compound Name | 2-dimethoxyphosphoryl-3,3-difluoro-2-(trifluoromethyl)oxirane |
|---|---|
| PubChem CID | 12829625 |
| Molecular Formula | C5H6F5O4P |
| Molecular Weight | 256.06 g/mol |
| Exact Mass | 255.99 |
| IUPAC Name | 2-dimethoxyphosphoryl-3,3-difluoro-2-(trifluoromethyl)oxirane |
| SMILES | COP(=O)(OC)C1(C(F)(F)F)OC1(F)F |
| InChI | InChI=1S/C5H6F5O4P/c1-12-15(11,13-2)3(4(6,7)8)5(9,10)14-3/h1-2H3 |
| InChIKey | BKHYCRAGFWUYPN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.06 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|