About 2-dimethoxyphosphoryl-3,3-difluoro-2-(trifluoromethyl)oxirane
2-dimethoxyphosphoryl-3,3-difluoro-2-(trifluoromethyl)oxirane (PubChem CID 12829625) has the molecular formula C5H6F5O4P
and a molecular weight of 256.06 g/mol. Its IUPAC name is 2-dimethoxyphosphoryl-3,3-difluoro-2-(trifluoromethyl)oxirane.
Molecular Properties
| Compound Name | 2-dimethoxyphosphoryl-3,3-difluoro-2-(trifluoromethyl)oxirane |
| PubChem CID | 12829625 |
| Molecular Formula | C5H6F5O4P |
| Molecular Weight | 256.06 g/mol |
| Exact Mass | 255.99 |
| IUPAC Name | 2-dimethoxyphosphoryl-3,3-difluoro-2-(trifluoromethyl)oxirane |
| SMILES | COP(=O)(OC)C1(C(F)(F)F)OC1(F)F |
| InChI | InChI=1S/C5H6F5O4P/c1-12-15(11,13-2)3(4(6,7)8)5(9,10)14-3/h1-2H3 |
| InChIKey | BKHYCRAGFWUYPN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.06 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-dimethoxyphosphoryl-3,3-difluoro-2-(trifluoromethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dimethoxyphosphoryl-3,3-difluoro-2-(trifluoromethyl)oxirane?
The IUPAC name of 2-dimethoxyphosphoryl-3,3-difluoro-2-(trifluoromethyl)oxirane (CID 12829625) is 2-dimethoxyphosphoryl-3,3-difluoro-2-(trifluoromethyl)oxirane.
What is the SMILES notation for 2-dimethoxyphosphoryl-3,3-difluoro-2-(trifluoromethyl)oxirane?
The canonical SMILES for 2-dimethoxyphosphoryl-3,3-difluoro-2-(trifluoromethyl)oxirane is COP(=O)(OC)C1(C(F)(F)F)OC1(F)F.
What is the InChIKey of 2-dimethoxyphosphoryl-3,3-difluoro-2-(trifluoromethyl)oxirane?
The InChIKey is BKHYCRAGFWUYPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6F5O4P/c1-12-15(11,13-2)3(4(6,7)8)5(9,10)14-3/h1-2H3.
What are the key properties of 2-dimethoxyphosphoryl-3,3-difluoro-2-(trifluoromethyl)oxirane?
2-dimethoxyphosphoryl-3,3-difluoro-2-(trifluoromethyl)oxirane has a molecular weight of 256.06 g/mol, XLogP of 2.35, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dimethoxyphosphoryl-3,3-difluoro-2-(trifluoromethyl)oxirane is sourced from PubChem (CID 12829625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).