C8H11F3NO5PS — CID 639222
4-dimethoxyphosphoryl-1-(trifluoromethylsulfonyl)-4H-pyridine (PubChem CID 639222) has the molecular formula C8H11F3NO5PS and a molecular weight of 321.21 g/mol. Its IUPAC name is 4-dimethoxyphosphoryl-1-(trifluoromethylsulfonyl)-4H-pyridine.
| Compound Name | 4-dimethoxyphosphoryl-1-(trifluoromethylsulfonyl)-4H-pyridine |
|---|---|
| PubChem CID | 639222 |
| Molecular Formula | C8H11F3NO5PS |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 4-dimethoxyphosphoryl-1-(trifluoromethylsulfonyl)-4H-pyridine |
| SMILES | COP(=O)(OC)C1C=CN(S(=O)(=O)C(F)(F)F)C=C1 |
| InChI | InChI=1S/C8H11F3NO5PS/c1-16-18(13,17-2)7-3-5-12(6-4-7)19(14,15)8(9,10)11/h3-7H,1-2H3 |
| InChIKey | AWKLCVUVMRADBC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|