C8F16O — CID 19026789
2,2,3,3,4,4,5-heptafluoro-5-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxolane (PubChem CID 19026789) has the molecular formula C8F16O and a molecular weight of 416.06 g/mol. Its IUPAC name is 2,2,3,3,4,4,5-heptafluoro-5-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxolane.
| Compound Name | 2,2,3,3,4,4,5-heptafluoro-5-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxolane |
|---|---|
| PubChem CID | 19026789 |
| Molecular Formula | C8F16O |
| Molecular Weight | 416.06 g/mol |
| Exact Mass | 415.97 |
| IUPAC Name | 2,2,3,3,4,4,5-heptafluoro-5-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxolane |
| SMILES | FC(F)(F)C(C(F)(F)F)(C(F)(F)F)C1(F)OC(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8F16O/c9-2(10)3(11,12)8(23,24)25-4(2,13)1(5(14,15)16,6(17,18)19)7(20,21)22 |
| InChIKey | DBJDWFSYQDPLQJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.06 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|