C4F7IO — CID 71417311
2,2,3,3,4,4,5-heptafluoro-5-iodooxolane (PubChem CID 71417311) has the molecular formula C4F7IO and a molecular weight of 323.93 g/mol. Its IUPAC name is 2,2,3,3,4,4,5-heptafluoro-5-iodooxolane.
| Compound Name | 2,2,3,3,4,4,5-heptafluoro-5-iodooxolane |
|---|---|
| PubChem CID | 71417311 |
| Molecular Formula | C4F7IO |
| Molecular Weight | 323.93 g/mol |
| Exact Mass | 323.89 |
| IUPAC Name | 2,2,3,3,4,4,5-heptafluoro-5-iodooxolane |
| SMILES | FC1(F)OC(F)(I)C(F)(F)C1(F)F |
| InChI | InChI=1S/C4F7IO/c5-1(6)2(7,8)4(11,12)13-3(1,9)10 |
| InChIKey | DVZMHVZLRXYZLF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.93 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|