C14F26O5 — CID 14921076
(1S,15S)-1,3,3,4,4,6,6,7,7,9,9,10,10,12,12,13,13,15,16,16,17,17,18,18,19,19-hexacosafluoro-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadecane (PubChem CID 14921076) has the molecular formula C14F26O5 and a molecular weight of 742.10 g/mol. Its IUPAC name is (1S,15S)-1,3,3,4,4,6,6,7,7,9,9,10,10,12,12,13,13,15,16,16,17,17,18,18,19,19-hexacosafluoro-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadecane.
| Compound Name | (1S,15S)-1,3,3,4,4,6,6,7,7,9,9,10,10,12,12,13,13,15,16,16,17,17,18,18,19,19-hexacosafluoro-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadecane |
|---|---|
| PubChem CID | 14921076 |
| Molecular Formula | C14F26O5 |
| Molecular Weight | 742.10 g/mol |
| Exact Mass | 741.93 |
| IUPAC Name | (1S,15S)-1,3,3,4,4,6,6,7,7,9,9,10,10,12,12,13,13,15,16,16,17,17,18,18,19,19-hexacosafluoro-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadecane |
| SMILES | FC1(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)O[C@@]2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)[C@]2(F)OC(F)(F)C(F)(F)OC1(F)F |
| InChI | InChI=1S/C14F26O5/c15-1(16)2(17,18)4(21,22)6(24)5(23,3(1,19)20)41-7(25,26)9(29,30)43-11(33,34)13(37,38)45-14(39,40)12(35,36)44-10(31,32)8(27,28)42-6/t5-,6-/m0/s1 |
| InChIKey | XTWDMDUMHCMIEU-WDSKDSINSA-N |
| XLogP | 7.71 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.10 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|