C7H9F7O2Si — CID 71395773
(2,3,3,5,5,6,6-heptafluoro-1,4-dioxan-2-yl)-trimethylsilane (PubChem CID 71395773) has the molecular formula C7H9F7O2Si and a molecular weight of 286.22 g/mol. Its IUPAC name is (2,3,3,5,5,6,6-heptafluoro-1,4-dioxan-2-yl)-trimethylsilane.
| Compound Name | (2,3,3,5,5,6,6-heptafluoro-1,4-dioxan-2-yl)-trimethylsilane |
|---|---|
| PubChem CID | 71395773 |
| Molecular Formula | C7H9F7O2Si |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | (2,3,3,5,5,6,6-heptafluoro-1,4-dioxan-2-yl)-trimethylsilane |
| SMILES | C[Si](C)(C)C1(F)OC(F)(F)C(F)(F)OC1(F)F |
| InChI | InChI=1S/C7H9F7O2Si/c1-17(2,3)7(14)6(12,13)15-4(8,9)5(10,11)16-7/h1-3H3 |
| InChIKey | XRMQMHJENHEHPM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|