C5H3F9OSi — CID 173148599
(2,3,3,4,4,5,5,6,6-nonafluorooxan-2-yl)silane (PubChem CID 173148599) has the molecular formula C5H3F9OSi and a molecular weight of 278.15 g/mol. Its IUPAC name is (2,3,3,4,4,5,5,6,6-nonafluorooxan-2-yl)silane.
| Compound Name | (2,3,3,4,4,5,5,6,6-nonafluorooxan-2-yl)silane |
|---|---|
| PubChem CID | 173148599 |
| Molecular Formula | C5H3F9OSi |
| Molecular Weight | 278.15 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | (2,3,3,4,4,5,5,6,6-nonafluorooxan-2-yl)silane |
| SMILES | FC1(F)OC(F)([SiH3])C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C5H3F9OSi/c6-1(7)2(8,9)4(12,13)15-5(14,16)3(1,10)11/h16H3 |
| InChIKey | DOUUOBYYSBRZAP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.15 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|