C6H6F6O — CID 118020327
2,2,3,4,4,5-hexafluoro-3,5-dimethyloxolane (PubChem CID 118020327) has the molecular formula C6H6F6O and a molecular weight of 208.10 g/mol. Its IUPAC name is 2,2,3,4,4,5-hexafluoro-3,5-dimethyloxolane.
| Compound Name | 2,2,3,4,4,5-hexafluoro-3,5-dimethyloxolane |
|---|---|
| PubChem CID | 118020327 |
| Molecular Formula | C6H6F6O |
| Molecular Weight | 208.10 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 2,2,3,4,4,5-hexafluoro-3,5-dimethyloxolane |
| SMILES | CC1(F)OC(F)(F)C(C)(F)C1(F)F |
| InChI | InChI=1S/C6H6F6O/c1-3(7)5(9,10)4(2,8)13-6(3,11)12/h1-2H3 |
| InChIKey | KIEBMCKJRYKHFU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.10 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |