C6F12O — CID 22808848
(3S,5R)-2,2,3,4,4,5-hexafluoro-3,5-bis(trifluoromethyl)oxolane (PubChem CID 22808848) has the molecular formula C6F12O and a molecular weight of 316.04 g/mol. Its IUPAC name is (3S,5R)-2,2,3,4,4,5-hexafluoro-3,5-bis(trifluoromethyl)oxolane.
| Compound Name | (3S,5R)-2,2,3,4,4,5-hexafluoro-3,5-bis(trifluoromethyl)oxolane |
|---|---|
| PubChem CID | 22808848 |
| Molecular Formula | C6F12O |
| Molecular Weight | 316.04 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | (3S,5R)-2,2,3,4,4,5-hexafluoro-3,5-bis(trifluoromethyl)oxolane |
| SMILES | FC(F)(F)[C@@]1(F)OC(F)(F)[C@](F)(C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C6F12O/c7-1(4(11,12)13)2(8,9)3(10,5(14,15)16)19-6(1,17)18/t1-,3+/m1/s1 |
| InChIKey | LLRDUIXNNHUYLY-GPKNORDASA-N |
| XLogP | 3.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.04 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |