C4F8O2 — CID 22497786
2,2,4,4,5,5,6,6-octafluoro-1,3-dioxane (PubChem CID 22497786) has the molecular formula C4F8O2 and a molecular weight of 232.03 g/mol. Its IUPAC name is 2,2,4,4,5,5,6,6-octafluoro-1,3-dioxane.
| Compound Name | 2,2,4,4,5,5,6,6-octafluoro-1,3-dioxane |
|---|---|
| PubChem CID | 22497786 |
| Molecular Formula | C4F8O2 |
| Molecular Weight | 232.03 g/mol |
| Exact Mass | 231.98 |
| IUPAC Name | 2,2,4,4,5,5,6,6-octafluoro-1,3-dioxane |
| SMILES | FC1(F)OC(F)(F)C(F)(F)C(F)(F)O1 |
| InChI | InChI=1S/C4F8O2/c5-1(6)2(7,8)13-4(11,12)14-3(1,9)10 |
| InChIKey | RQGSWPUTHJZOGI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.03 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|