C4F6O3 — CID 11333283
2,2,4,5,5-pentafluoro-1,3-dioxolane-4-carbonyl fluoride (PubChem CID 11333283) has the molecular formula C4F6O3 and a molecular weight of 210.03 g/mol. Its IUPAC name is 2,2,4,5,5-pentafluoro-1,3-dioxolane-4-carbonyl fluoride.
| Compound Name | 2,2,4,5,5-pentafluoro-1,3-dioxolane-4-carbonyl fluoride |
|---|---|
| PubChem CID | 11333283 |
| Molecular Formula | C4F6O3 |
| Molecular Weight | 210.03 g/mol |
| Exact Mass | 209.98 |
| IUPAC Name | 2,2,4,5,5-pentafluoro-1,3-dioxolane-4-carbonyl fluoride |
| SMILES | O=C(F)C1(F)OC(F)(F)OC1(F)F |
| InChI | InChI=1S/C4F6O3/c5-1(11)2(6)3(7,8)13-4(9,10)12-2 |
| InChIKey | VGPBGUZCCILHGR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.03 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|