C8F12O2 — CID 88638074
2,2,3,3,4,4,5,5,6,6-decafluorocyclohexane-1,1-dicarbonyl fluoride (PubChem CID 88638074) has the molecular formula C8F12O2 and a molecular weight of 356.06 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decafluorocyclohexane-1,1-dicarbonyl fluoride.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decafluorocyclohexane-1,1-dicarbonyl fluoride |
|---|---|
| PubChem CID | 88638074 |
| Molecular Formula | C8F12O2 |
| Molecular Weight | 356.06 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decafluorocyclohexane-1,1-dicarbonyl fluoride |
| SMILES | O=C(F)C1(C(=O)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8F12O2/c9-1(21)3(2(10)22)4(11,12)6(15,16)8(19,20)7(17,18)5(3,13)14 |
| InChIKey | FRMPBEORYJIMOZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.06 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|