C6ClF9O — CID 141293641
1,2,2,3,3,4,4,5,5-nonafluorocyclopentane-1-carbonyl chloride (PubChem CID 141293641) has the molecular formula C6ClF9O and a molecular weight of 294.50 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5-nonafluorocyclopentane-1-carbonyl chloride.
| Compound Name | 1,2,2,3,3,4,4,5,5-nonafluorocyclopentane-1-carbonyl chloride |
|---|---|
| PubChem CID | 141293641 |
| Molecular Formula | C6ClF9O |
| Molecular Weight | 294.50 g/mol |
| Exact Mass | 293.95 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5-nonafluorocyclopentane-1-carbonyl chloride |
| SMILES | O=C(Cl)C1(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C6ClF9O/c7-1(17)2(8)3(9,10)5(13,14)6(15,16)4(2,11)12 |
| InChIKey | MZXDVFCRYSYZDK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|