C11BrF17O — CID 139893717
1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-heptadecafluoronaphthalene-1-carbonyl bromide (PubChem CID 139893717) has the molecular formula C11BrF17O and a molecular weight of 550.99 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-heptadecafluoronaphthalene-1-carbonyl bromide.
| Compound Name | 1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-heptadecafluoronaphthalene-1-carbonyl bromide |
|---|---|
| PubChem CID | 139893717 |
| Molecular Formula | C11BrF17O |
| Molecular Weight | 550.99 g/mol |
| Exact Mass | 549.89 |
| IUPAC Name | 1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-heptadecafluoronaphthalene-1-carbonyl bromide |
| SMILES | O=C(Br)C1(F)C(F)(F)C(F)(F)C(F)(F)C2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C12F |
| InChI | InChI=1S/C11BrF17O/c12-1(30)2(13)3(14)4(15,7(20,21)9(24,25)5(2,16)17)8(22,23)11(28,29)10(26,27)6(3,18)19 |
| InChIKey | DFFKUAKQYZNDBN-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.99 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|