C7F12O3S — CID 19807657
1,2,2,3,3,4,5,5,6,6-decafluoro-4-fluorosulfonylcyclohexane-1-carbonyl fluoride (PubChem CID 19807657) has the molecular formula C7F12O3S and a molecular weight of 392.12 g/mol. Its IUPAC name is 1,2,2,3,3,4,5,5,6,6-decafluoro-4-fluorosulfonylcyclohexane-1-carbonyl fluoride.
| Compound Name | 1,2,2,3,3,4,5,5,6,6-decafluoro-4-fluorosulfonylcyclohexane-1-carbonyl fluoride |
|---|---|
| PubChem CID | 19807657 |
| Molecular Formula | C7F12O3S |
| Molecular Weight | 392.12 g/mol |
| Exact Mass | 391.94 |
| IUPAC Name | 1,2,2,3,3,4,5,5,6,6-decafluoro-4-fluorosulfonylcyclohexane-1-carbonyl fluoride |
| SMILES | O=C(F)C1(F)C(F)(F)C(F)(F)C(F)(S(=O)(=O)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C7F12O3S/c8-1(20)2(9)3(10,11)5(14,15)7(18,23(19,21)22)6(16,17)4(2,12)13 |
| InChIKey | IVJIFDJKLSUYEB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.12 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|