C9HF11O3 — CID 58854936
1,2,2,3,4,4,5,6-octafluorocyclohexane-1,3,5-tricarbonyl fluoride (PubChem CID 58854936) has the molecular formula C9HF11O3 and a molecular weight of 366.08 g/mol. Its IUPAC name is 1,2,2,3,4,4,5,6-octafluorocyclohexane-1,3,5-tricarbonyl fluoride.
| Compound Name | 1,2,2,3,4,4,5,6-octafluorocyclohexane-1,3,5-tricarbonyl fluoride |
|---|---|
| PubChem CID | 58854936 |
| Molecular Formula | C9HF11O3 |
| Molecular Weight | 366.08 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | 1,2,2,3,4,4,5,6-octafluorocyclohexane-1,3,5-tricarbonyl fluoride |
| SMILES | O=C(F)C1(F)C(F)C(F)(C(=O)F)C(F)(F)C(F)(C(=O)F)C1(F)F |
| InChI | InChI=1S/C9HF11O3/c10-1-5(14,2(11)21)8(17,18)7(16,4(13)23)9(19,20)6(1,15)3(12)22/h1H |
| InChIKey | ZKAFZYQVPGNOKE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.08 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|