C10H5F11O4 — CID 89354580
2,2,4,4,6,6,8,8,9,9,10-undecafluoroadamantane-1,3,5,7-tetrol (PubChem CID 89354580) has the molecular formula C10H5F11O4 and a molecular weight of 398.12 g/mol. Its IUPAC name is 2,2,4,4,6,6,8,8,9,9,10-undecafluoroadamantane-1,3,5,7-tetrol.
| Compound Name | 2,2,4,4,6,6,8,8,9,9,10-undecafluoroadamantane-1,3,5,7-tetrol |
|---|---|
| PubChem CID | 89354580 |
| Molecular Formula | C10H5F11O4 |
| Molecular Weight | 398.12 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | 2,2,4,4,6,6,8,8,9,9,10-undecafluoroadamantane-1,3,5,7-tetrol |
| SMILES | OC12C(F)C3(O)C(F)(F)C(O)(C1(F)F)C(F)(F)C(O)(C2(F)F)C3(F)F |
| InChI | InChI=1S/C10H5F11O4/c11-1-2(22)6(12,13)4(24)8(16,17)3(1,23)9(18,19)5(25,7(2,14)15)10(4,20)21/h1,22-25H |
| InChIKey | JXNANFQOJRPBDX-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.12 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |