C5H2F8 — CID 2778426
1,1,2,2,3,3,4,5-octafluorocyclopentane (PubChem CID 2778426) has the molecular formula C5H2F8 and a molecular weight of 214.06 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,5-octafluorocyclopentane.
| Compound Name | 1,1,2,2,3,3,4,5-octafluorocyclopentane |
|---|---|
| PubChem CID | 2778426 |
| Molecular Formula | C5H2F8 |
| Molecular Weight | 214.06 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 1,1,2,2,3,3,4,5-octafluorocyclopentane |
| SMILES | FC1C(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C5H2F8/c6-1-2(7)4(10,11)5(12,13)3(1,8)9/h1-2H |
| InChIKey | QVEJLBREDQLBKB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.06 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|