C6H4F8 — CID 22495201
1,1,2,2,3,4,5,6-octafluorocyclohexane (PubChem CID 22495201) has the molecular formula C6H4F8 and a molecular weight of 228.08 g/mol. Its IUPAC name is 1,1,2,2,3,4,5,6-octafluorocyclohexane.
| Compound Name | 1,1,2,2,3,4,5,6-octafluorocyclohexane |
|---|---|
| PubChem CID | 22495201 |
| Molecular Formula | C6H4F8 |
| Molecular Weight | 228.08 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 1,1,2,2,3,4,5,6-octafluorocyclohexane |
| SMILES | FC1C(F)C(F)C(F)(F)C(F)(F)C1F |
| InChI | InChI=1S/C6H4F8/c7-1-2(8)4(10)6(13,14)5(11,12)3(1)9/h1-4H |
| InChIKey | RNCHYDBESOPKQF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.08 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|