C5H4F6O2 — CID 150455539
3,3,4,4,5,5-hexafluorocyclopentane-1,2-diol (PubChem CID 150455539) has the molecular formula C5H4F6O2 and a molecular weight of 210.07 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluorocyclopentane-1,2-diol.
| Compound Name | 3,3,4,4,5,5-hexafluorocyclopentane-1,2-diol |
|---|---|
| PubChem CID | 150455539 |
| Molecular Formula | C5H4F6O2 |
| Molecular Weight | 210.07 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | 3,3,4,4,5,5-hexafluorocyclopentane-1,2-diol |
| SMILES | OC1C(O)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C5H4F6O2/c6-3(7)1(12)2(13)4(8,9)5(3,10)11/h1-2,12-13H |
| InChIKey | HORZSSSFLXYYCG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.07 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|