C14H4F20 — CID 88625549
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-icosafluoro-4a,8a,9a,10a-tetrahydroanthracene (PubChem CID 88625549) has the molecular formula C14H4F20 and a molecular weight of 552.15 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-icosafluoro-4a,8a,9a,10a-tetrahydroanthracene.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-icosafluoro-4a,8a,9a,10a-tetrahydroanthracene |
|---|---|
| PubChem CID | 88625549 |
| Molecular Formula | C14H4F20 |
| Molecular Weight | 552.15 g/mol |
| Exact Mass | 552.00 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-icosafluoro-4a,8a,9a,10a-tetrahydroanthracene |
| SMILES | FC1(F)C2C(C(F)(F)C3C1C(F)(F)C(F)(F)C(F)(F)C3(F)F)C(F)(F)C(F)(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C14H4F20/c15-5(16)1-2(8(21,22)12(29,30)11(27,28)7(1,19)20)6(17,18)4-3(5)9(23,24)13(31,32)14(33,34)10(4,25)26/h1-4H |
| InChIKey | QVFXJFGBAZPDIA-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.15 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|