C7H7F7 — CID 155107426
1,1,2,2,3,3,4-heptafluoro-4,5-dimethylcyclopentane (PubChem CID 155107426) has the molecular formula C7H7F7 and a molecular weight of 224.12 g/mol. Its IUPAC name is 1,1,2,2,3,3,4-heptafluoro-4,5-dimethylcyclopentane.
| Compound Name | 1,1,2,2,3,3,4-heptafluoro-4,5-dimethylcyclopentane |
|---|---|
| PubChem CID | 155107426 |
| Molecular Formula | C7H7F7 |
| Molecular Weight | 224.12 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 1,1,2,2,3,3,4-heptafluoro-4,5-dimethylcyclopentane |
| SMILES | CC1C(C)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C7H7F7/c1-3-4(2,8)6(11,12)7(13,14)5(3,9)10/h3H,1-2H3 |
| InChIKey | HCUVAGQXIPEUFT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.12 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|