C10H2F16 — CID 21225585
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-4a,8a-dihydronaphthalene (PubChem CID 21225585) has the molecular formula C10H2F16 and a molecular weight of 426.09 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-4a,8a-dihydronaphthalene.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-4a,8a-dihydronaphthalene |
|---|---|
| PubChem CID | 21225585 |
| Molecular Formula | C10H2F16 |
| Molecular Weight | 426.09 g/mol |
| Exact Mass | 425.99 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-4a,8a-dihydronaphthalene |
| SMILES | FC1(F)C2C(C(F)(F)C(F)(F)C1(F)F)C(F)(F)C(F)(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C10H2F16/c11-3(12)1-2(5(15,16)9(23,24)7(3,19)20)6(17,18)10(25,26)8(21,22)4(1,13)14/h1-2H |
| InChIKey | ULEPXMHCYXSIAB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.09 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|