C12H7F14N — CID 88680709
2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-1-prop-2-enyl-4a,8a-dihydroquinoline (PubChem CID 88680709) has the molecular formula C12H7F14N and a molecular weight of 431.17 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-1-prop-2-enyl-4a,8a-dihydroquinoline.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-1-prop-2-enyl-4a,8a-dihydroquinoline |
|---|---|
| PubChem CID | 88680709 |
| Molecular Formula | C12H7F14N |
| Molecular Weight | 431.17 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-1-prop-2-enyl-4a,8a-dihydroquinoline |
| SMILES | C=CCN1C2C(C(F)(F)C(F)(F)C1(F)F)C(F)(F)C(F)(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C12H7F14N/c1-2-3-27-5-4(7(15,16)11(23,24)12(27,25)26)6(13,14)9(19,20)10(21,22)8(5,17)18/h2,4-5H,1,3H2 |
| InChIKey | IKDFQIHGWRTNDD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.17 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|