C7H13NO2 — CID 72779960
1-prop-2-enylpyrrolidine-3,4-diol (PubChem CID 72779960) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is 1-prop-2-enylpyrrolidine-3,4-diol.
| Compound Name | 1-prop-2-enylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 72779960 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 1-prop-2-enylpyrrolidine-3,4-diol |
| SMILES | C=CCN1CC(O)C(O)C1 |
| InChI | InChI=1S/C7H13NO2/c1-2-3-8-4-6(9)7(10)5-8/h2,6-7,9-10H,1,3-5H2 |
| InChIKey | HRBXGVGYORAILE-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|