C9H3F15 — CID 160699918
1,1,2,2,3,3-hexafluorocyclobutane;1,1,2,2,3,3,4,4,5-nonafluorocyclopentane (PubChem CID 160699918) has the molecular formula C9H3F15 and a molecular weight of 396.09 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluorocyclobutane;1,1,2,2,3,3,4,4,5-nonafluorocyclopentane.
| Compound Name | 1,1,2,2,3,3-hexafluorocyclobutane;1,1,2,2,3,3,4,4,5-nonafluorocyclopentane |
|---|---|
| PubChem CID | 160699918 |
| Molecular Formula | C9H3F15 |
| Molecular Weight | 396.09 g/mol |
| Exact Mass | 396.00 |
| IUPAC Name | 1,1,2,2,3,3-hexafluorocyclobutane;1,1,2,2,3,3,4,4,5-nonafluorocyclopentane |
| SMILES | FC1(F)CC(F)(F)C1(F)F.FC1C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C5HF9.C4H2F6/c6-1-2(7,8)4(11,12)5(13,14)3(1,9)10;5-2(6)1-3(7,8)4(2,9)10/h1H;1H2 |
| InChIKey | RQMFUZWEJRNOCD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.09 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|