C9H8F8O2 — CID 13451011
2-(1,2,2,3,3,4,4,5-octafluorocyclopentyl)-1,4-dioxane (PubChem CID 13451011) has the molecular formula C9H8F8O2 and a molecular weight of 300.15 g/mol. Its IUPAC name is 2-(1,2,2,3,3,4,4,5-octafluorocyclopentyl)-1,4-dioxane.
| Compound Name | 2-(1,2,2,3,3,4,4,5-octafluorocyclopentyl)-1,4-dioxane |
|---|---|
| PubChem CID | 13451011 |
| Molecular Formula | C9H8F8O2 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 2-(1,2,2,3,3,4,4,5-octafluorocyclopentyl)-1,4-dioxane |
| SMILES | FC1C(F)(F)C(F)(F)C(F)(F)C1(F)C1COCCO1 |
| InChI | InChI=1S/C9H8F8O2/c10-5-6(11,4-3-18-1-2-19-4)8(14,15)9(16,17)7(5,12)13/h4-5H,1-3H2 |
| InChIKey | OIXQANJDGZEQMU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|