C5HClF6O — CID 162536529
1,2,2,3,3,4-hexafluorocyclobutane-1-carbonyl chloride (PubChem CID 162536529) has the molecular formula C5HClF6O and a molecular weight of 226.50 g/mol. Its IUPAC name is 1,2,2,3,3,4-hexafluorocyclobutane-1-carbonyl chloride.
| Compound Name | 1,2,2,3,3,4-hexafluorocyclobutane-1-carbonyl chloride |
|---|---|
| PubChem CID | 162536529 |
| Molecular Formula | C5HClF6O |
| Molecular Weight | 226.50 g/mol |
| Exact Mass | 225.96 |
| IUPAC Name | 1,2,2,3,3,4-hexafluorocyclobutane-1-carbonyl chloride |
| SMILES | O=C(Cl)C1(F)C(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C5HClF6O/c6-2(13)3(8)1(7)4(9,10)5(3,11)12/h1H |
| InChIKey | OZACLLQERRDFAP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.50 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|