C10H6F10O4 — CID 89354579
2,2,4,4,6,6,8,8,9,10-decafluoroadamantane-1,3,5,7-tetrol (PubChem CID 89354579) has the molecular formula C10H6F10O4 and a molecular weight of 380.13 g/mol. Its IUPAC name is 2,2,4,4,6,6,8,8,9,10-decafluoroadamantane-1,3,5,7-tetrol.
| Compound Name | 2,2,4,4,6,6,8,8,9,10-decafluoroadamantane-1,3,5,7-tetrol |
|---|---|
| PubChem CID | 89354579 |
| Molecular Formula | C10H6F10O4 |
| Molecular Weight | 380.13 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | 2,2,4,4,6,6,8,8,9,10-decafluoroadamantane-1,3,5,7-tetrol |
| SMILES | OC12C(F)C3(O)C(F)(F)C(O)(C(F)C(O)(C1(F)F)C3(F)F)C2(F)F |
| InChI | InChI=1S/C10H6F10O4/c11-1-3(21)7(13,14)5(23)2(12)6(24,8(3,15)16)10(19,20)4(1,22)9(5,17)18/h1-2,21-24H |
| InChIKey | STEDJQGXPQQGDA-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.13 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |