C6H2F6O — CID 175095832
1,2,3,4,5,6-hexafluorocyclohexa-2,4-dien-1-ol (PubChem CID 175095832) has the molecular formula C6H2F6O and a molecular weight of 204.07 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexafluorocyclohexa-2,4-dien-1-ol.
| Compound Name | 1,2,3,4,5,6-hexafluorocyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 175095832 |
| Molecular Formula | C6H2F6O |
| Molecular Weight | 204.07 g/mol |
| Exact Mass | 204.00 |
| IUPAC Name | 1,2,3,4,5,6-hexafluorocyclohexa-2,4-dien-1-ol |
| SMILES | OC1(F)C(F)=C(F)C(F)=C(F)C1F |
| InChI | InChI=1S/C6H2F6O/c7-1-2(8)4(10)6(12,13)5(11)3(1)9/h4,13H |
| InChIKey | KPBJBKLHQZOAQP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.07 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |