C28H16BF20- — CID 174225846
tetrakis(1,2,3,4,5-pentafluoro-6-methylcyclohexa-2,4-dien-1-yl)boranuide (PubChem CID 174225846) has the molecular formula C28H16BF20- and a molecular weight of 743.21 g/mol. Its IUPAC name is tetrakis(1,2,3,4,5-pentafluoro-6-methylcyclohexa-2,4-dien-1-yl)boranuide.
| Compound Name | tetrakis(1,2,3,4,5-pentafluoro-6-methylcyclohexa-2,4-dien-1-yl)boranuide |
|---|---|
| PubChem CID | 174225846 |
| Molecular Formula | C28H16BF20- |
| Molecular Weight | 743.21 g/mol |
| Exact Mass | 743.10 |
| IUPAC Name | tetrakis(1,2,3,4,5-pentafluoro-6-methylcyclohexa-2,4-dien-1-yl)boranuide |
| SMILES | CC1C(F)=C(F)C(F)=C(F)C1(F)[B-](C1(F)C(F)=C(F)C(F)=C(F)C1C)(C1(F)C(F)=C(F)C(F)=C(F)C1C)C1(F)C(F)=C(F)C(F)=C(F)C1C |
| InChI | InChI=1S/C28H16BF20/c1-5-9(30)13(34)17(38)21(42)25(5,46)29(26(47)6(2)10(31)14(35)18(39)22(26)43,27(48)7(3)11(32)15(36)19(40)23(27)44)28(49)8(4)12(33)16(37)20(41)24(28)45/h5-8H,1-4H3/q-1 |
| InChIKey | GDIKAKPIPUGEJZ-UHFFFAOYSA-N |
| XLogP | 12.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.21 |
| LogP ≤ 5 | 12.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|