C6H4F6 — CID 87084189
1,2,3,3,4,4-hexafluoro-5-methylcyclopentene (PubChem CID 87084189) has the molecular formula C6H4F6 and a molecular weight of 190.09 g/mol. Its IUPAC name is 1,2,3,3,4,4-hexafluoro-5-methylcyclopentene.
| Compound Name | 1,2,3,3,4,4-hexafluoro-5-methylcyclopentene |
|---|---|
| PubChem CID | 87084189 |
| Molecular Formula | C6H4F6 |
| Molecular Weight | 190.09 g/mol |
| Exact Mass | 190.02 |
| IUPAC Name | 1,2,3,3,4,4-hexafluoro-5-methylcyclopentene |
| SMILES | CC1C(F)=C(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C6H4F6/c1-2-3(7)4(8)6(11,12)5(2,9)10/h2H,1H3 |
| InChIKey | JZOAXSYHWKEDTB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.09 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|