C12H10F4O2 — CID 177403647
1,4,5,6-tetrafluoro-7-methyl-8-[(Z)-prop-1-enyl]bicyclo[2.2.2]oct-5-ene-2,3-dione (PubChem CID 177403647) has the molecular formula C12H10F4O2 and a molecular weight of 262.20 g/mol. Its IUPAC name is 1,4,5,6-tetrafluoro-7-methyl-8-[(Z)-prop-1-enyl]bicyclo[2.2.2]oct-5-ene-2,3-dione.
| Compound Name | 1,4,5,6-tetrafluoro-7-methyl-8-[(Z)-prop-1-enyl]bicyclo[2.2.2]oct-5-ene-2,3-dione |
|---|---|
| PubChem CID | 177403647 |
| Molecular Formula | C12H10F4O2 |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 1,4,5,6-tetrafluoro-7-methyl-8-[(Z)-prop-1-enyl]bicyclo[2.2.2]oct-5-ene-2,3-dione |
| SMILES | C/C=C\C1C(C)C2(F)C(=O)C(=O)C1(F)C(F)=C2F |
| InChI | InChI=1S/C12H10F4O2/c1-3-4-6-5(2)11(15)7(13)8(14)12(6,16)10(18)9(11)17/h3-6H,1-2H3/b4-3- |
| InChIKey | XAWDVTMGGVVWSS-ARJAWSKDSA-N |
| XLogP | 2.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|